jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

Which two countries were the first to declare war on Germany in WWII?

the 42 foot tree casts a shadow of 63 feet. how long is a shadow of a 5 foot girl who is standing near it

What's 45 out of 58 in percentage?

Find the original cost of a rocker selling for $159.95 at 20% off.

What is the coefficient of x in the expression x-2? Explain your reasoning.

If Olivia and Shawn have another child, which of the following genotypes is possible for the child? A. Mm only B. MM only C. MM or mm only D. MM, Mm, or mm

Write equation in function form y-3x-11=0

Explain the connection, or relationship between a protagonist and an antagonist.

How do I solve c/4d divided by 3/8d

is a piece of cloth a point, line, or plane?